C18H24N2O3S — CID 169419084
N-cyclobutyl-4-(2-phenylsulfanylacetyl)-1,4-oxazepane-6-carboxamide (PubChem CID 169419084) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-cyclobutyl-4-(2-phenylsulfanylacetyl)-1,4-oxazepane-6-carboxamide.
| Compound Name | N-cyclobutyl-4-(2-phenylsulfanylacetyl)-1,4-oxazepane-6-carboxamide |
|---|---|
| PubChem CID | 169419084 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-cyclobutyl-4-(2-phenylsulfanylacetyl)-1,4-oxazepane-6-carboxamide |
| SMILES | O=C(NC1CCC1)C1COCCN(C(=O)CSc2ccccc2)C1 |
| InChI | InChI=1S/C18H24N2O3S/c21-17(13-24-16-7-2-1-3-8-16)20-9-10-23-12-14(11-20)18(22)19-15-5-4-6-15/h1-3,7-8,14-15H,4-6,9-13H2,(H,19,22) |
| InChIKey | FQSMTVMURFASSK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |