C20H26O3PS+ — CID 67615098
(1-ethoxy-2,4-dimethyl-1-oxopentan-2-yl)-(naphthalen-1-ylsulfanylmethyl)-oxophosphanium (PubChem CID 67615098) has the molecular formula C20H26O3PS+ and a molecular weight of 377.47 g/mol. Its IUPAC name is (1-ethoxy-2,4-dimethyl-1-oxopentan-2-yl)-(naphthalen-1-ylsulfanylmethyl)-oxophosphanium.
| Compound Name | (1-ethoxy-2,4-dimethyl-1-oxopentan-2-yl)-(naphthalen-1-ylsulfanylmethyl)-oxophosphanium |
|---|---|
| PubChem CID | 67615098 |
| Molecular Formula | C20H26O3PS+ |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (1-ethoxy-2,4-dimethyl-1-oxopentan-2-yl)-(naphthalen-1-ylsulfanylmethyl)-oxophosphanium |
| SMILES | CCOC(=O)C(C)(CC(C)C)[P+](=O)CSc1cccc2ccccc12 |
| InChI | InChI=1S/C20H26O3PS/c1-5-23-19(21)20(4,13-15(2)3)24(22)14-25-18-12-8-10-16-9-6-7-11-17(16)18/h6-12,15H,5,13-14H2,1-4H3/q+1 |
| InChIKey | CUECFVMLACDZDD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|