C30H36O3Si — CID 10743080
ethyl 2-(cyclohexylmethyl)-3-[2-[hydroxy(diphenyl)silyl]phenyl]propanoate (PubChem CID 10743080) has the molecular formula C30H36O3Si and a molecular weight of 472.70 g/mol. Its IUPAC name is ethyl 2-(cyclohexylmethyl)-3-[2-[hydroxy(diphenyl)silyl]phenyl]propanoate.
| Compound Name | ethyl 2-(cyclohexylmethyl)-3-[2-[hydroxy(diphenyl)silyl]phenyl]propanoate |
|---|---|
| PubChem CID | 10743080 |
| Molecular Formula | C30H36O3Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | ethyl 2-(cyclohexylmethyl)-3-[2-[hydroxy(diphenyl)silyl]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1[Si](O)(c1ccccc1)c1ccccc1)CC1CCCCC1 |
| InChI | InChI=1S/C30H36O3Si/c1-2-33-30(31)26(22-24-14-6-3-7-15-24)23-25-16-12-13-21-29(25)34(32,27-17-8-4-9-18-27)28-19-10-5-11-20-28/h4-5,8-13,16-21,24,26,32H,2-3,6-7,14-15,22-23H2,1H3 |
| InChIKey | NOGDSWFEUFSRCQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|