C18H24O4 — CID 67664820
2-[[2-(acetyloxymethyl)phenyl]methyl]-3-cyclopentylpropanoic acid (PubChem CID 67664820) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[[2-(acetyloxymethyl)phenyl]methyl]-3-cyclopentylpropanoic acid.
| Compound Name | 2-[[2-(acetyloxymethyl)phenyl]methyl]-3-cyclopentylpropanoic acid |
|---|---|
| PubChem CID | 67664820 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-[[2-(acetyloxymethyl)phenyl]methyl]-3-cyclopentylpropanoic acid |
| SMILES | CC(=O)OCc1ccccc1CC(CC1CCCC1)C(=O)O |
| InChI | InChI=1S/C18H24O4/c1-13(19)22-12-16-9-5-4-8-15(16)11-17(18(20)21)10-14-6-2-3-7-14/h4-5,8-9,14,17H,2-3,6-7,10-12H2,1H3,(H,20,21) |
| InChIKey | CGYYQJCEZWBCAE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |