C28H33ClO3Si — CID 10672397
ethyl 7-chloro-2-[[2-[hydroxy(diphenyl)silyl]phenyl]methyl]heptanoate (PubChem CID 10672397) has the molecular formula C28H33ClO3Si and a molecular weight of 481.11 g/mol. Its IUPAC name is ethyl 7-chloro-2-[[2-[hydroxy(diphenyl)silyl]phenyl]methyl]heptanoate.
| Compound Name | ethyl 7-chloro-2-[[2-[hydroxy(diphenyl)silyl]phenyl]methyl]heptanoate |
|---|---|
| PubChem CID | 10672397 |
| Molecular Formula | C28H33ClO3Si |
| Molecular Weight | 481.11 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | ethyl 7-chloro-2-[[2-[hydroxy(diphenyl)silyl]phenyl]methyl]heptanoate |
| SMILES | CCOC(=O)C(CCCCCCl)Cc1ccccc1[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33ClO3Si/c1-2-32-28(30)24(15-6-5-13-21-29)22-23-14-11-12-20-27(23)33(31,25-16-7-3-8-17-25)26-18-9-4-10-19-26/h3-4,7-12,14,16-20,24,31H,2,5-6,13,15,21-22H2,1H3 |
| InChIKey | IANJKOOTUJBWHU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.11 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|