C23H28O4 — CID 15913968
diethyl 2-[(2-phenylphenyl)methyl]hexanedioate (PubChem CID 15913968) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is diethyl 2-[(2-phenylphenyl)methyl]hexanedioate.
| Compound Name | diethyl 2-[(2-phenylphenyl)methyl]hexanedioate |
|---|---|
| PubChem CID | 15913968 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | diethyl 2-[(2-phenylphenyl)methyl]hexanedioate |
| SMILES | CCOC(=O)CCCC(Cc1ccccc1-c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C23H28O4/c1-3-26-22(24)16-10-14-20(23(25)27-4-2)17-19-13-8-9-15-21(19)18-11-6-5-7-12-18/h5-9,11-13,15,20H,3-4,10,14,16-17H2,1-2H3 |
| InChIKey | YLCVEZWMZSGEEK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |