C24H30O4 — CID 139921100
[4-[2-(pentanoyloxymethyl)phenyl]phenyl]methyl pentanoate (PubChem CID 139921100) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is [4-[2-(pentanoyloxymethyl)phenyl]phenyl]methyl pentanoate.
| Compound Name | [4-[2-(pentanoyloxymethyl)phenyl]phenyl]methyl pentanoate |
|---|---|
| PubChem CID | 139921100 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [4-[2-(pentanoyloxymethyl)phenyl]phenyl]methyl pentanoate |
| SMILES | CCCCC(=O)OCc1ccc(-c2ccccc2COC(=O)CCCC)cc1 |
| InChI | InChI=1S/C24H30O4/c1-3-5-11-23(25)27-17-19-13-15-20(16-14-19)22-10-8-7-9-21(22)18-28-24(26)12-6-4-2/h7-10,13-16H,3-6,11-12,17-18H2,1-2H3 |
| InChIKey | BZHQAXCDFSAXFV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |