C54H92N2O4 — CID 139955324
[4-[4-[4-(dioctylamino)butanoyloxymethyl]phenyl]phenyl]methyl 4-(dioctylamino)butanoate (PubChem CID 139955324) has the molecular formula C54H92N2O4 and a molecular weight of 833.34 g/mol. Its IUPAC name is [4-[4-[4-(dioctylamino)butanoyloxymethyl]phenyl]phenyl]methyl 4-(dioctylamino)butanoate.
| Compound Name | [4-[4-[4-(dioctylamino)butanoyloxymethyl]phenyl]phenyl]methyl 4-(dioctylamino)butanoate |
|---|---|
| PubChem CID | 139955324 |
| Molecular Formula | C54H92N2O4 |
| Molecular Weight | 833.34 g/mol |
| Exact Mass | 832.71 |
| IUPAC Name | [4-[4-[4-(dioctylamino)butanoyloxymethyl]phenyl]phenyl]methyl 4-(dioctylamino)butanoate |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCC(=O)OCc1ccc(-c2ccc(COC(=O)CCCN(CCCCCCCC)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C54H92N2O4/c1-5-9-13-17-21-25-41-55(42-26-22-18-14-10-6-2)45-29-31-53(57)59-47-49-33-37-51(38-34-49)52-39-35-50(36-40-52)48-60-54(58)32-30-46-56(43-27-23-19-15-11-7-3)44-28-24-20-16-12-8-4/h33-40H,5-32,41-48H2,1-4H3 |
| InChIKey | BHVJVCJRFRETKY-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.34 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|