C48H80N2O4 — CID 139955663
[4-[4-[3-[hexyl(octyl)amino]propanoyloxymethyl]phenyl]phenyl]methyl 3-[hexyl(octyl)amino]propanoate (PubChem CID 139955663) has the molecular formula C48H80N2O4 and a molecular weight of 749.18 g/mol. Its IUPAC name is [4-[4-[3-[hexyl(octyl)amino]propanoyloxymethyl]phenyl]phenyl]methyl 3-[hexyl(octyl)amino]propanoate.
| Compound Name | [4-[4-[3-[hexyl(octyl)amino]propanoyloxymethyl]phenyl]phenyl]methyl 3-[hexyl(octyl)amino]propanoate |
|---|---|
| PubChem CID | 139955663 |
| Molecular Formula | C48H80N2O4 |
| Molecular Weight | 749.18 g/mol |
| Exact Mass | 748.61 |
| IUPAC Name | [4-[4-[3-[hexyl(octyl)amino]propanoyloxymethyl]phenyl]phenyl]methyl 3-[hexyl(octyl)amino]propanoate |
| SMILES | CCCCCCCCN(CCCCCC)CCC(=O)OCc1ccc(-c2ccc(COC(=O)CCN(CCCCCC)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C48H80N2O4/c1-5-9-13-17-19-23-37-49(35-21-15-11-7-3)39-33-47(51)53-41-43-25-29-45(30-26-43)46-31-27-44(28-32-46)42-54-48(52)34-40-50(36-22-16-12-8-4)38-24-20-18-14-10-6-2/h25-32H,5-24,33-42H2,1-4H3 |
| InChIKey | WWZLUAUPRYKFRQ-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.18 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|