C38H60N2O4 — CID 139954314
[4-[4-[[2-[butyl(hexyl)amino]acetyl]oxymethyl]phenyl]phenyl]methyl 2-[butyl(hexyl)amino]acetate (PubChem CID 139954314) has the molecular formula C38H60N2O4 and a molecular weight of 608.91 g/mol. Its IUPAC name is [4-[4-[[2-[butyl(hexyl)amino]acetyl]oxymethyl]phenyl]phenyl]methyl 2-[butyl(hexyl)amino]acetate.
| Compound Name | [4-[4-[[2-[butyl(hexyl)amino]acetyl]oxymethyl]phenyl]phenyl]methyl 2-[butyl(hexyl)amino]acetate |
|---|---|
| PubChem CID | 139954314 |
| Molecular Formula | C38H60N2O4 |
| Molecular Weight | 608.91 g/mol |
| Exact Mass | 608.46 |
| IUPAC Name | [4-[4-[[2-[butyl(hexyl)amino]acetyl]oxymethyl]phenyl]phenyl]methyl 2-[butyl(hexyl)amino]acetate |
| SMILES | CCCCCCN(CCCC)CC(=O)OCc1ccc(-c2ccc(COC(=O)CN(CCCC)CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C38H60N2O4/c1-5-9-13-15-27-39(25-11-7-3)29-37(41)43-31-33-17-21-35(22-18-33)36-23-19-34(20-24-36)32-44-38(42)30-40(26-12-8-4)28-16-14-10-6-2/h17-24H,5-16,25-32H2,1-4H3 |
| InChIKey | HWQFKVWCSRUYHT-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.91 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|