C25H34N2O4 — CID 59502420
benzyl 2-[6-(methylamino)hexyl-(2-oxo-2-phenylmethoxyethyl)amino]acetate (PubChem CID 59502420) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is benzyl 2-[6-(methylamino)hexyl-(2-oxo-2-phenylmethoxyethyl)amino]acetate.
| Compound Name | benzyl 2-[6-(methylamino)hexyl-(2-oxo-2-phenylmethoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 59502420 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | benzyl 2-[6-(methylamino)hexyl-(2-oxo-2-phenylmethoxyethyl)amino]acetate |
| SMILES | CNCCCCCCN(CC(=O)OCc1ccccc1)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H34N2O4/c1-26-16-10-2-3-11-17-27(18-24(28)30-20-22-12-6-4-7-13-22)19-25(29)31-21-23-14-8-5-9-15-23/h4-9,12-15,26H,2-3,10-11,16-21H2,1H3 |
| InChIKey | ZGGSSUCUPXBASL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|