C22H27NO5 — CID 154635765
4-[(2-oxo-2-phenylmethoxyethyl)-(2-phenylmethoxyethyl)amino]butanoic acid (PubChem CID 154635765) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-[(2-oxo-2-phenylmethoxyethyl)-(2-phenylmethoxyethyl)amino]butanoic acid.
| Compound Name | 4-[(2-oxo-2-phenylmethoxyethyl)-(2-phenylmethoxyethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 154635765 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-[(2-oxo-2-phenylmethoxyethyl)-(2-phenylmethoxyethyl)amino]butanoic acid |
| SMILES | O=C(O)CCCN(CCOCc1ccccc1)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO5/c24-21(25)12-7-13-23(14-15-27-17-19-8-3-1-4-9-19)16-22(26)28-18-20-10-5-2-6-11-20/h1-6,8-11H,7,12-18H2,(H,24,25) |
| InChIKey | CFUPHFSZXACYOA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|