C13H11F3N2OS — CID 35990470
2-quinolin-2-ylsulfanyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 35990470) has the molecular formula C13H11F3N2OS and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-quinolin-2-ylsulfanyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-quinolin-2-ylsulfanyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 35990470 |
| Molecular Formula | C13H11F3N2OS |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-quinolin-2-ylsulfanyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CSc1ccc2ccccc2n1)NCC(F)(F)F |
| InChI | InChI=1S/C13H11F3N2OS/c14-13(15,16)8-17-11(19)7-20-12-6-5-9-3-1-2-4-10(9)18-12/h1-6H,7-8H2,(H,17,19) |
| InChIKey | HMHQYNUSGVIELC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |