C13H10N4OS2 — CID 23738300
2-quinolin-2-ylsulfanyl-N-(1,2,4-thiadiazol-3-yl)acetamide (PubChem CID 23738300) has the molecular formula C13H10N4OS2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-quinolin-2-ylsulfanyl-N-(1,2,4-thiadiazol-3-yl)acetamide.
| Compound Name | 2-quinolin-2-ylsulfanyl-N-(1,2,4-thiadiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 23738300 |
| Molecular Formula | C13H10N4OS2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-quinolin-2-ylsulfanyl-N-(1,2,4-thiadiazol-3-yl)acetamide |
| SMILES | O=C(CSc1ccc2ccccc2n1)Nc1ncsn1 |
| InChI | InChI=1S/C13H10N4OS2/c18-11(16-13-14-8-20-17-13)7-19-12-6-5-9-3-1-2-4-10(9)15-12/h1-6,8H,7H2,(H,16,17,18) |
| InChIKey | RTILAGXGNNOLCK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |