C18H12ClN3OS — CID 7755226
N-(5-chloro-2-cyanophenyl)-2-quinolin-2-ylsulfanylacetamide (PubChem CID 7755226) has the molecular formula C18H12ClN3OS and a molecular weight of 353.83 g/mol. Its IUPAC name is N-(5-chloro-2-cyanophenyl)-2-quinolin-2-ylsulfanylacetamide.
| Compound Name | N-(5-chloro-2-cyanophenyl)-2-quinolin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 7755226 |
| Molecular Formula | C18H12ClN3OS |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-(5-chloro-2-cyanophenyl)-2-quinolin-2-ylsulfanylacetamide |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)CSc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H12ClN3OS/c19-14-7-5-13(10-20)16(9-14)21-17(23)11-24-18-8-6-12-3-1-2-4-15(12)22-18/h1-9H,11H2,(H,21,23) |
| InChIKey | WTAKFWCPKSDICS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |