C19H14ClF3N2OS — CID 39765776
N-[5-chloro-2-(trifluoromethyl)phenyl]-3-quinolin-2-ylsulfanylpropanamide (PubChem CID 39765776) has the molecular formula C19H14ClF3N2OS and a molecular weight of 410.85 g/mol. Its IUPAC name is N-[5-chloro-2-(trifluoromethyl)phenyl]-3-quinolin-2-ylsulfanylpropanamide.
| Compound Name | N-[5-chloro-2-(trifluoromethyl)phenyl]-3-quinolin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 39765776 |
| Molecular Formula | C19H14ClF3N2OS |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-[5-chloro-2-(trifluoromethyl)phenyl]-3-quinolin-2-ylsulfanylpropanamide |
| SMILES | O=C(CCSc1ccc2ccccc2n1)Nc1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H14ClF3N2OS/c20-13-6-7-14(19(21,22)23)16(11-13)24-17(26)9-10-27-18-8-5-12-3-1-2-4-15(12)25-18/h1-8,11H,9-10H2,(H,24,26) |
| InChIKey | XFJSMNGHZXHRMV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |