C12H10NNaO2S- — CID 20843421
CID 20843421 (PubChem CID 20843421) has the molecular formula C12H10NNaO2S- and a molecular weight of 255.27 g/mol.
| Compound Name | CID 20843421 |
|---|---|
| PubChem CID | 20843421 |
| Molecular Formula | C12H10NNaO2S- |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | — |
| SMILES | O=C([O-])CCSc1ccc2ccccc2n1.[Na] |
| InChI | InChI=1S/C12H11NO2S.Na/c14-12(15)7-8-16-11-6-5-9-3-1-2-4-10(9)13-11;/h1-6H,7-8H2,(H,14,15);/p-1 |
| InChIKey | SIJFVTQASFHJJS-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |