C14H20O3 — CID 175280398
2-hydroxy-4-methyl-2-[(2-methylphenyl)methyl]pentanoic acid (PubChem CID 175280398) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-2-[(2-methylphenyl)methyl]pentanoic acid.
| Compound Name | 2-hydroxy-4-methyl-2-[(2-methylphenyl)methyl]pentanoic acid |
|---|---|
| PubChem CID | 175280398 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-hydroxy-4-methyl-2-[(2-methylphenyl)methyl]pentanoic acid |
| SMILES | Cc1ccccc1CC(O)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C14H20O3/c1-10(2)8-14(17,13(15)16)9-12-7-5-4-6-11(12)3/h4-7,10,17H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | CZLWSEZGRYEVIE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |