C18H21NO2 — CID 106509102
2-(aminomethyl)-2,3-bis(2-methylphenyl)propanoic acid (PubChem CID 106509102) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(aminomethyl)-2,3-bis(2-methylphenyl)propanoic acid.
| Compound Name | 2-(aminomethyl)-2,3-bis(2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 106509102 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-(aminomethyl)-2,3-bis(2-methylphenyl)propanoic acid |
| SMILES | Cc1ccccc1CC(CN)(C(=O)O)c1ccccc1C |
| InChI | InChI=1S/C18H21NO2/c1-13-7-3-5-9-15(13)11-18(12-19,17(20)21)16-10-6-4-8-14(16)2/h3-10H,11-12,19H2,1-2H3,(H,20,21) |
| InChIKey | FOHXJCKNUXIFLX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |