C16H26OS2 — CID 11022914
4-methyl-3-[(2-methylphenyl)methyl]-1,1-bis(methylsulfanyl)pentan-3-ol (PubChem CID 11022914) has the molecular formula C16H26OS2 and a molecular weight of 298.52 g/mol. Its IUPAC name is 4-methyl-3-[(2-methylphenyl)methyl]-1,1-bis(methylsulfanyl)pentan-3-ol.
| Compound Name | 4-methyl-3-[(2-methylphenyl)methyl]-1,1-bis(methylsulfanyl)pentan-3-ol |
|---|---|
| PubChem CID | 11022914 |
| Molecular Formula | C16H26OS2 |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-methyl-3-[(2-methylphenyl)methyl]-1,1-bis(methylsulfanyl)pentan-3-ol |
| SMILES | CSC(CC(O)(Cc1ccccc1C)C(C)C)SC |
| InChI | InChI=1S/C16H26OS2/c1-12(2)16(17,11-15(18-4)19-5)10-14-9-7-6-8-13(14)3/h6-9,12,15,17H,10-11H2,1-5H3 |
| InChIKey | YPQYEWYKZGFZAF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|