C23H31O6PS — CID 140982333
ethyl 2-ethoxy-2-[(4-methylphenyl)sulfonyloxymethylphosphanylmethyl]-4-phenylbutanoate (PubChem CID 140982333) has the molecular formula C23H31O6PS and a molecular weight of 466.54 g/mol. Its IUPAC name is ethyl 2-ethoxy-2-[(4-methylphenyl)sulfonyloxymethylphosphanylmethyl]-4-phenylbutanoate.
| Compound Name | ethyl 2-ethoxy-2-[(4-methylphenyl)sulfonyloxymethylphosphanylmethyl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 140982333 |
| Molecular Formula | C23H31O6PS |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | ethyl 2-ethoxy-2-[(4-methylphenyl)sulfonyloxymethylphosphanylmethyl]-4-phenylbutanoate |
| SMILES | CCOC(=O)C(CCc1ccccc1)(CPCOS(=O)(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C23H31O6PS/c1-4-27-22(24)23(28-5-2,16-15-20-9-7-6-8-10-20)17-30-18-29-31(25,26)21-13-11-19(3)12-14-21/h6-14,30H,4-5,15-18H2,1-3H3 |
| InChIKey | VPMUMMXIGNMFMS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|