C16H26O2S — CID 11076913
2-methyl-3-(phenylsulfanylmethyl)octane-2,3-diol (PubChem CID 11076913) has the molecular formula C16H26O2S and a molecular weight of 282.45 g/mol. Its IUPAC name is 2-methyl-3-(phenylsulfanylmethyl)octane-2,3-diol.
| Compound Name | 2-methyl-3-(phenylsulfanylmethyl)octane-2,3-diol |
|---|---|
| PubChem CID | 11076913 |
| Molecular Formula | C16H26O2S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-methyl-3-(phenylsulfanylmethyl)octane-2,3-diol |
| SMILES | CCCCCC(O)(CSc1ccccc1)C(C)(C)O |
| InChI | InChI=1S/C16H26O2S/c1-4-5-9-12-16(18,15(2,3)17)13-19-14-10-7-6-8-11-14/h6-8,10-11,17-18H,4-5,9,12-13H2,1-3H3 |
| InChIKey | MUDYBAWZEFEFBE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|