C16H24O2S — CID 90393356
4-methyl-4-phenylsulfanylnonanoic acid (PubChem CID 90393356) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is 4-methyl-4-phenylsulfanylnonanoic acid.
| Compound Name | 4-methyl-4-phenylsulfanylnonanoic acid |
|---|---|
| PubChem CID | 90393356 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 4-methyl-4-phenylsulfanylnonanoic acid |
| SMILES | CCCCCC(C)(CCC(=O)O)Sc1ccccc1 |
| InChI | InChI=1S/C16H24O2S/c1-3-4-8-12-16(2,13-11-15(17)18)19-14-9-6-5-7-10-14/h5-7,9-10H,3-4,8,11-13H2,1-2H3,(H,17,18) |
| InChIKey | RHIVVJBKFXXMLT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|