C20H23F3S2 — CID 101038516
(1,1,1-trifluoro-2-phenylsulfanyloctan-2-yl)sulfanylbenzene (PubChem CID 101038516) has the molecular formula C20H23F3S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-phenylsulfanyloctan-2-yl)sulfanylbenzene.
| Compound Name | (1,1,1-trifluoro-2-phenylsulfanyloctan-2-yl)sulfanylbenzene |
|---|---|
| PubChem CID | 101038516 |
| Molecular Formula | C20H23F3S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (1,1,1-trifluoro-2-phenylsulfanyloctan-2-yl)sulfanylbenzene |
| SMILES | CCCCCCC(Sc1ccccc1)(Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H23F3S2/c1-2-3-4-11-16-19(20(21,22)23,24-17-12-7-5-8-13-17)25-18-14-9-6-10-15-18/h5-10,12-15H,2-4,11,16H2,1H3 |
| InChIKey | IXASLAQSTTZTFG-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|