C17H22Cl2S — CID 10853791
1,1-dichloroundec-2-ynylsulfanylbenzene (PubChem CID 10853791) has the molecular formula C17H22Cl2S and a molecular weight of 329.34 g/mol. Its IUPAC name is 1,1-dichloroundec-2-ynylsulfanylbenzene.
| Compound Name | 1,1-dichloroundec-2-ynylsulfanylbenzene |
|---|---|
| PubChem CID | 10853791 |
| Molecular Formula | C17H22Cl2S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1,1-dichloroundec-2-ynylsulfanylbenzene |
| SMILES | CCCCCCCCC#CC(Cl)(Cl)Sc1ccccc1 |
| InChI | InChI=1S/C17H22Cl2S/c1-2-3-4-5-6-7-8-12-15-17(18,19)20-16-13-10-9-11-14-16/h9-11,13-14H,2-8H2,1H3 |
| InChIKey | FCNYXVAEJFPKQR-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|