C32H50O2PS2+ — CID 71532363
tributyl-[7-carboxy-5,5-bis(phenylsulfanyl)heptyl]phosphanium (PubChem CID 71532363) has the molecular formula C32H50O2PS2+ and a molecular weight of 561.86 g/mol. Its IUPAC name is tributyl-[7-carboxy-5,5-bis(phenylsulfanyl)heptyl]phosphanium.
| Compound Name | tributyl-[7-carboxy-5,5-bis(phenylsulfanyl)heptyl]phosphanium |
|---|---|
| PubChem CID | 71532363 |
| Molecular Formula | C32H50O2PS2+ |
| Molecular Weight | 561.86 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | tributyl-[7-carboxy-5,5-bis(phenylsulfanyl)heptyl]phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCCC(CCC(=O)O)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C32H49O2PS2/c1-4-7-25-35(26-8-5-2,27-9-6-3)28-17-16-23-32(24-22-31(33)34,36-29-18-12-10-13-19-29)37-30-20-14-11-15-21-30/h10-15,18-21H,4-9,16-17,22-28H2,1-3H3/p+1 |
| InChIKey | RIXHTMVFKDTFPI-UHFFFAOYSA-O |
| XLogP | 10.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.86 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|