C23H29NO3S2 — CID 166768173
7-(butylamino)-7-oxo-4,4-bis(phenylsulfanyl)heptanoic acid (PubChem CID 166768173) has the molecular formula C23H29NO3S2 and a molecular weight of 431.62 g/mol. Its IUPAC name is 7-(butylamino)-7-oxo-4,4-bis(phenylsulfanyl)heptanoic acid.
| Compound Name | 7-(butylamino)-7-oxo-4,4-bis(phenylsulfanyl)heptanoic acid |
|---|---|
| PubChem CID | 166768173 |
| Molecular Formula | C23H29NO3S2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 7-(butylamino)-7-oxo-4,4-bis(phenylsulfanyl)heptanoic acid |
| SMILES | CCCCNC(=O)CCC(CCC(=O)O)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C23H29NO3S2/c1-2-3-18-24-21(25)14-16-23(17-15-22(26)27,28-19-10-6-4-7-11-19)29-20-12-8-5-9-13-20/h4-13H,2-3,14-18H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | KBBGHJXVMPZDJT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|