C19H22O3S2 — CID 138548628
7-hydroxy-4,4-bis(phenylsulfanyl)heptanoic acid (PubChem CID 138548628) has the molecular formula C19H22O3S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 7-hydroxy-4,4-bis(phenylsulfanyl)heptanoic acid.
| Compound Name | 7-hydroxy-4,4-bis(phenylsulfanyl)heptanoic acid |
|---|---|
| PubChem CID | 138548628 |
| Molecular Formula | C19H22O3S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 7-hydroxy-4,4-bis(phenylsulfanyl)heptanoic acid |
| SMILES | O=C(O)CCC(CCCO)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C19H22O3S2/c20-15-7-13-19(14-12-18(21)22,23-16-8-3-1-4-9-16)24-17-10-5-2-6-11-17/h1-6,8-11,20H,7,12-15H2,(H,21,22) |
| InChIKey | YGWDFKATJKTUHP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|