C26H46O2PS+ — CID 90393243
tributyl-(6-carboxy-4-methyl-4-phenylsulfanylhexyl)phosphanium (PubChem CID 90393243) has the molecular formula C26H46O2PS+ and a molecular weight of 453.69 g/mol. Its IUPAC name is tributyl-(6-carboxy-4-methyl-4-phenylsulfanylhexyl)phosphanium.
| Compound Name | tributyl-(6-carboxy-4-methyl-4-phenylsulfanylhexyl)phosphanium |
|---|---|
| PubChem CID | 90393243 |
| Molecular Formula | C26H46O2PS+ |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | tributyl-(6-carboxy-4-methyl-4-phenylsulfanylhexyl)phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC(C)(CCC(=O)O)Sc1ccccc1 |
| InChI | InChI=1S/C26H45O2PS/c1-5-8-20-29(21-9-6-2,22-10-7-3)23-14-18-26(4,19-17-25(27)28)30-24-15-12-11-13-16-24/h11-13,15-16H,5-10,14,17-23H2,1-4H3/p+1 |
| InChIKey | UNNMYDWNEWBCKR-UHFFFAOYSA-O |
| XLogP | 8.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|