C45H78N2O6PSSi+ — CID 160838696
tributyl-[7-[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-tri(propan-2-yl)silyloxyoxolan-3-yl]oxy-4-methyl-7-oxo-4-phenylsulfanylheptyl]phosphanium (PubChem CID 160838696) has the molecular formula C45H78N2O6PSSi+ and a molecular weight of 834.25 g/mol. Its IUPAC name is tributyl-[7-[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-tri(propan-2-yl)silyloxyoxolan-3-yl]oxy-4-methyl-7-oxo-4-phenylsulfanylheptyl]phosphanium.
| Compound Name | tributyl-[7-[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-tri(propan-2-yl)silyloxyoxolan-3-yl]oxy-4-methyl-7-oxo-4-phenylsulfanylheptyl]phosphanium |
|---|---|
| PubChem CID | 160838696 |
| Molecular Formula | C45H78N2O6PSSi+ |
| Molecular Weight | 834.25 g/mol |
| Exact Mass | 833.51 |
| IUPAC Name | tributyl-[7-[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-tri(propan-2-yl)silyloxyoxolan-3-yl]oxy-4-methyl-7-oxo-4-phenylsulfanylheptyl]phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC(C)(CCC(=O)O[C@@H]1C(O[Si](C(C)C)(C(C)C)C(C)C)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CC)Sc1ccccc1 |
| InChI | InChI=1S/C45H77N2O6PSSi/c1-12-16-30-54(31-17-13-2,32-18-14-3)33-22-27-45(11,55-37-23-20-19-21-24-37)28-25-40(49)52-41-38(15-4)51-43(47-29-26-39(48)46-44(47)50)42(41)53-56(34(5)6,35(7)8)36(9)10/h19-21,23-24,26,29,34-36,38,41-43H,12-18,22,25,27-28,30-33H2,1-11H3/p+1/t38-,41+,42?,43-,45?/m1/s1 |
| InChIKey | NVHRIAMOIQDXAH-RLZMOYLNSA-O |
| XLogP | 11.85 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.25 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|