C30H51N3O8Si — CID 90393372
[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-tri(propan-2-yl)silyloxyoxolan-3-yl] 7-(butylamino)-4,7-dioxoheptanoate (PubChem CID 90393372) has the molecular formula C30H51N3O8Si and a molecular weight of 609.84 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-tri(propan-2-yl)silyloxyoxolan-3-yl] 7-(butylamino)-4,7-dioxoheptanoate.
| Compound Name | [(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-tri(propan-2-yl)silyloxyoxolan-3-yl] 7-(butylamino)-4,7-dioxoheptanoate |
|---|---|
| PubChem CID | 90393372 |
| Molecular Formula | C30H51N3O8Si |
| Molecular Weight | 609.84 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | [(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-tri(propan-2-yl)silyloxyoxolan-3-yl] 7-(butylamino)-4,7-dioxoheptanoate |
| SMILES | CCCCNC(=O)CCC(=O)CCC(=O)OC1[C@@H](CC)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H51N3O8Si/c1-9-11-17-31-24(35)14-12-22(34)13-15-26(37)40-27-23(10-2)39-29(33-18-16-25(36)32-30(33)38)28(27)41-42(19(3)4,20(5)6)21(7)8/h16,18-21,23,27-29H,9-15,17H2,1-8H3,(H,31,35)(H,32,36,38)/t23-,27?,28+,29-/m1/s1 |
| InChIKey | GWAYWSBSLJFAOS-VKZBBXDISA-N |
| XLogP | 4.36 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|