C24H27O4P — CID 22617656
2-[[benzyl(hydroxy)phosphoryl]methyl]-4-naphthalen-1-ylhexanoic acid (PubChem CID 22617656) has the molecular formula C24H27O4P and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-[[benzyl(hydroxy)phosphoryl]methyl]-4-naphthalen-1-ylhexanoic acid.
| Compound Name | 2-[[benzyl(hydroxy)phosphoryl]methyl]-4-naphthalen-1-ylhexanoic acid |
|---|---|
| PubChem CID | 22617656 |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[[benzyl(hydroxy)phosphoryl]methyl]-4-naphthalen-1-ylhexanoic acid |
| SMILES | CCC(CC(CP(=O)(O)Cc1ccccc1)C(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H27O4P/c1-2-19(22-14-8-12-20-11-6-7-13-23(20)22)15-21(24(25)26)17-29(27,28)16-18-9-4-3-5-10-18/h3-14,19,21H,2,15-17H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | JKAGFPPZMVHLER-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|