C25H34NO6P — CID 13373225
2-[[hydroxy(4-phenylbutyl)phosphoryl]methyl]-6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 13373225) has the molecular formula C25H34NO6P and a molecular weight of 475.52 g/mol. Its IUPAC name is 2-[[hydroxy(4-phenylbutyl)phosphoryl]methyl]-6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | 2-[[hydroxy(4-phenylbutyl)phosphoryl]methyl]-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 13373225 |
| Molecular Formula | C25H34NO6P |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-[[hydroxy(4-phenylbutyl)phosphoryl]methyl]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | O=C(NCCCCC(CP(=O)(O)CCCCc1ccccc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C25H34NO6P/c27-24(28)23(20-33(30,31)18-10-8-13-21-11-3-1-4-12-21)16-7-9-17-26-25(29)32-19-22-14-5-2-6-15-22/h1-6,11-12,14-15,23H,7-10,13,16-20H2,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | SODQCIJQQIMOSJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|