C32H42N2O3 — CID 66859905
benzyl N-[4-[4-[(4R)-4-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]pentyl]phenyl]butyl]carbamate (PubChem CID 66859905) has the molecular formula C32H42N2O3 and a molecular weight of 502.70 g/mol. Its IUPAC name is benzyl N-[4-[4-[(4R)-4-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]pentyl]phenyl]butyl]carbamate.
| Compound Name | benzyl N-[4-[4-[(4R)-4-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]pentyl]phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 66859905 |
| Molecular Formula | C32H42N2O3 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | benzyl N-[4-[4-[(4R)-4-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]pentyl]phenyl]butyl]carbamate |
| SMILES | C[C@H](CCCc1ccc(CCCCNC(=O)OCc2ccccc2)cc1)N[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C32H42N2O3/c1-25(34-26(2)31(35)30-17-7-4-8-18-30)12-11-16-28-21-19-27(20-22-28)13-9-10-23-33-32(36)37-24-29-14-5-3-6-15-29/h3-8,14-15,17-22,25-26,31,34-35H,9-13,16,23-24H2,1-2H3,(H,33,36)/t25-,26+,31+/m1/s1 |
| InChIKey | LCFOZXNWQFMCOY-WQQNLHNWSA-N |
| XLogP | 6.36 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|