C23H23NO5S — CID 18533132
2-[(4-benzoylphenyl)sulfanylmethyl]-5-(2,5-dioxopyrrolidin-1-yl)pentanoic acid (PubChem CID 18533132) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[(4-benzoylphenyl)sulfanylmethyl]-5-(2,5-dioxopyrrolidin-1-yl)pentanoic acid.
| Compound Name | 2-[(4-benzoylphenyl)sulfanylmethyl]-5-(2,5-dioxopyrrolidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 18533132 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-[(4-benzoylphenyl)sulfanylmethyl]-5-(2,5-dioxopyrrolidin-1-yl)pentanoic acid |
| SMILES | O=C(c1ccccc1)c1ccc(SCC(CCCN2C(=O)CCC2=O)C(=O)O)cc1 |
| InChI | InChI=1S/C23H23NO5S/c25-20-12-13-21(26)24(20)14-4-7-18(23(28)29)15-30-19-10-8-17(9-11-19)22(27)16-5-2-1-3-6-16/h1-3,5-6,8-11,18H,4,7,12-15H2,(H,28,29) |
| InChIKey | ITBWIDRGQLKOEG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|