C12H16O2S — CID 57071820
2-(benzylsulfanylmethyl)butanoic acid (PubChem CID 57071820) has the molecular formula C12H16O2S and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-(benzylsulfanylmethyl)butanoic acid.
| Compound Name | 2-(benzylsulfanylmethyl)butanoic acid |
|---|---|
| PubChem CID | 57071820 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-(benzylsulfanylmethyl)butanoic acid |
| SMILES | CCC(CSCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H16O2S/c1-2-11(12(13)14)9-15-8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,13,14) |
| InChIKey | IEWPLXMLLOFORA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |