C26H26N2O4S — CID 54453578
methyl (2S)-2-[[2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]-pyridin-3-ylamino]propanoate (PubChem CID 54453578) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]-pyridin-3-ylamino]propanoate.
| Compound Name | methyl (2S)-2-[[2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]-pyridin-3-ylamino]propanoate |
|---|---|
| PubChem CID | 54453578 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | methyl (2S)-2-[[2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]-pyridin-3-ylamino]propanoate |
| SMILES | COC(=O)[C@H](C)N(C(=O)C(CSC(=O)c1ccccc1)Cc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C26H26N2O4S/c1-19(25(30)32-2)28(23-14-9-15-27-17-23)24(29)22(16-20-10-5-3-6-11-20)18-33-26(31)21-12-7-4-8-13-21/h3-15,17,19,22H,16,18H2,1-2H3/t19-,22?/m0/s1 |
| InChIKey | WWPRRWGLEDVXPN-YDNXMHBPSA-N |
| XLogP | 4.41 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|