C27H27N3O6S — CID 19022732
2-anilino-2-[[2-benzyl-3-(pyridine-3-carbonylsulfanyl)propanoyl]amino]pentanedioic acid (PubChem CID 19022732) has the molecular formula C27H27N3O6S and a molecular weight of 521.60 g/mol. Its IUPAC name is 2-anilino-2-[[2-benzyl-3-(pyridine-3-carbonylsulfanyl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-anilino-2-[[2-benzyl-3-(pyridine-3-carbonylsulfanyl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 19022732 |
| Molecular Formula | C27H27N3O6S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 2-anilino-2-[[2-benzyl-3-(pyridine-3-carbonylsulfanyl)propanoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)C(CSC(=O)c1cccnc1)Cc1ccccc1)(Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H27N3O6S/c31-23(32)13-14-27(26(35)36,29-22-11-5-2-6-12-22)30-24(33)21(16-19-8-3-1-4-9-19)18-37-25(34)20-10-7-15-28-17-20/h1-12,15,17,21,29H,13-14,16,18H2,(H,30,33)(H,31,32)(H,35,36) |
| InChIKey | AMDAGZUVLJSQFC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 145.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|