C20H19NOS2 — CID 87951619
2-benzyl-3-sulfanyl-N-(4-thiophen-2-ylphenyl)propanamide (PubChem CID 87951619) has the molecular formula C20H19NOS2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-benzyl-3-sulfanyl-N-(4-thiophen-2-ylphenyl)propanamide.
| Compound Name | 2-benzyl-3-sulfanyl-N-(4-thiophen-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 87951619 |
| Molecular Formula | C20H19NOS2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-benzyl-3-sulfanyl-N-(4-thiophen-2-ylphenyl)propanamide |
| SMILES | O=C(Nc1ccc(-c2cccs2)cc1)C(CS)Cc1ccccc1 |
| InChI | InChI=1S/C20H19NOS2/c22-20(17(14-23)13-15-5-2-1-3-6-15)21-18-10-8-16(9-11-18)19-7-4-12-24-19/h1-12,17,23H,13-14H2,(H,21,22) |
| InChIKey | DDUGCVBAEWNKIB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|