C26H28N2O2S — CID 87988780
N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-4-phenyl-2-(sulfanylmethyl)butanamide (PubChem CID 87988780) has the molecular formula C26H28N2O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-4-phenyl-2-(sulfanylmethyl)butanamide.
| Compound Name | N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-4-phenyl-2-(sulfanylmethyl)butanamide |
|---|---|
| PubChem CID | 87988780 |
| Molecular Formula | C26H28N2O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-4-phenyl-2-(sulfanylmethyl)butanamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)Nc1ccccc1)C(CS)CCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O2S/c29-25(22(19-31)17-16-20-10-4-1-5-11-20)28-24(18-21-12-6-2-7-13-21)26(30)27-23-14-8-3-9-15-23/h1-15,22,24,31H,16-19H2,(H,27,30)(H,28,29)/t22?,24-/m0/s1 |
| InChIKey | HMGOBXNDKGVMEN-GITCGBDTSA-N |
| XLogP | 4.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|