C32H41N3O4P+ — CID 91934753
[2-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]carbamoyl]-4-phenylbutyl]-(N-benzyl-C-methylcarbonimidoyl)-dihydroxyphosphanium (PubChem CID 91934753) has the molecular formula C32H41N3O4P+ and a molecular weight of 562.67 g/mol. Its IUPAC name is [2-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]carbamoyl]-4-phenylbutyl]-(N-benzyl-C-methylcarbonimidoyl)-dihydroxyphosphanium.
| Compound Name | [2-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]carbamoyl]-4-phenylbutyl]-(N-benzyl-C-methylcarbonimidoyl)-dihydroxyphosphanium |
|---|---|
| PubChem CID | 91934753 |
| Molecular Formula | C32H41N3O4P+ |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | [2-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]carbamoyl]-4-phenylbutyl]-(N-benzyl-C-methylcarbonimidoyl)-dihydroxyphosphanium |
| SMILES | C/C(=N\Cc1ccccc1)[P+](O)(O)CC(CCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C32H40N3O4P/c1-24(2)21-30(32(37)34-29-17-11-6-12-18-29)35-31(36)28(20-19-26-13-7-4-8-14-26)23-40(38,39)25(3)33-22-27-15-9-5-10-16-27/h4-18,24,28,30,38-39H,19-23H2,1-3H3,(H-,34,35,36,37)/p+1/b33-25+/t28?,30-/m0/s1 |
| InChIKey | ZNFINTKVSAWBIM-LTBQIEIZSA-O |
| XLogP | 5.86 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|