C25H31N3O6 — CID 141017607
4-[[4-methyl-2-[[2-(nitromethyl)-5-phenylpentanoyl]amino]pentanoyl]amino]benzoic acid (PubChem CID 141017607) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is 4-[[4-methyl-2-[[2-(nitromethyl)-5-phenylpentanoyl]amino]pentanoyl]amino]benzoic acid.
| Compound Name | 4-[[4-methyl-2-[[2-(nitromethyl)-5-phenylpentanoyl]amino]pentanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 141017607 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 4-[[4-methyl-2-[[2-(nitromethyl)-5-phenylpentanoyl]amino]pentanoyl]amino]benzoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCCc1ccccc1)C[N+](=O)[O-])C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H31N3O6/c1-17(2)15-22(24(30)26-21-13-11-19(12-14-21)25(31)32)27-23(29)20(16-28(33)34)10-6-9-18-7-4-3-5-8-18/h3-5,7-8,11-14,17,20,22H,6,9-10,15-16H2,1-2H3,(H,26,30)(H,27,29)(H,31,32) |
| InChIKey | AMQXCMQROHGBQH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|