C32H36N4O8 — CID 10054380
4-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]amino]propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]benzoic acid (PubChem CID 10054380) has the molecular formula C32H36N4O8 and a molecular weight of 604.66 g/mol. Its IUPAC name is 4-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]amino]propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]amino]propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10054380 |
| Molecular Formula | C32H36N4O8 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 4-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]amino]propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]benzoic acid |
| SMILES | C[C@H](NC(=O)[C@H](C)NC(CCc1ccccc1)C(=O)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H36N4O8/c1-19(33-26(32(43)44)17-10-21-6-4-3-5-7-21)28(38)34-20(2)29(39)36-27(18-22-8-15-25(37)16-9-22)30(40)35-24-13-11-23(12-14-24)31(41)42/h3-9,11-16,19-20,26-27,33,37H,10,17-18H2,1-2H3,(H,34,38)(H,35,40)(H,36,39)(H,41,42)(H,43,44)/t19-,20-,26?,27-/m0/s1 |
| InChIKey | XCRLYPOASZKXDU-LZKSUBLZSA-N |
| XLogP | 2.33 |
| TPSA | 194.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |