C19H29N3O4S — CID 10222337
N-[(2S)-4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]-2-(sulfanylmethyl)hexanamide (PubChem CID 10222337) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]-2-(sulfanylmethyl)hexanamide.
| Compound Name | N-[(2S)-4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]-2-(sulfanylmethyl)hexanamide |
|---|---|
| PubChem CID | 10222337 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[(2S)-4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]-2-(sulfanylmethyl)hexanamide |
| SMILES | CCCCC(CS)C(=O)N[C@@H](CC(C)C)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H29N3O4S/c1-4-5-6-14(12-27)18(23)21-17(11-13(2)3)19(24)20-15-7-9-16(10-8-15)22(25)26/h7-10,13-14,17,27H,4-6,11-12H2,1-3H3,(H,20,24)(H,21,23)/t14?,17-/m0/s1 |
| InChIKey | GUQLSDAPEWQELT-JRZJBTRGSA-N |
| XLogP | 3.80 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|