C13H15N5O3S — CID 54465040
2-[5-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]tetrazol-2-yl]acetic acid (PubChem CID 54465040) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-[5-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]tetrazol-2-yl]acetic acid.
| Compound Name | 2-[5-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]tetrazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 54465040 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-[5-[[(2S)-2-benzyl-3-sulfanylpropanoyl]amino]tetrazol-2-yl]acetic acid |
| SMILES | O=C(O)Cn1nnc(NC(=O)[C@@H](CS)Cc2ccccc2)n1 |
| InChI | InChI=1S/C13H15N5O3S/c19-11(20)7-18-16-13(15-17-18)14-12(21)10(8-22)6-9-4-2-1-3-5-9/h1-5,10,22H,6-8H2,(H,19,20)(H,14,16,21)/t10-/m1/s1 |
| InChIKey | XEGAPXSQDCAGPI-SNVBAGLBSA-N |
| XLogP | 0.48 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|