C17H23NO3S — CID 88611504
4-[(2-benzyl-3-sulfanylpropanoyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 88611504) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 4-[(2-benzyl-3-sulfanylpropanoyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-benzyl-3-sulfanylpropanoyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 88611504 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-[(2-benzyl-3-sulfanylpropanoyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(=O)C(CS)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H23NO3S/c19-16(14(11-22)10-12-4-2-1-3-5-12)18-15-8-6-13(7-9-15)17(20)21/h1-5,13-15,22H,6-11H2,(H,18,19)(H,20,21) |
| InChIKey | DQCPZZQCXPWATM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|