C17H22INO3S — CID 88611505
4-[(2-benzyl-2-iodo-3-sulfanylpropanoyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 88611505) has the molecular formula C17H22INO3S and a molecular weight of 447.34 g/mol. Its IUPAC name is 4-[(2-benzyl-2-iodo-3-sulfanylpropanoyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-benzyl-2-iodo-3-sulfanylpropanoyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 88611505 |
| Molecular Formula | C17H22INO3S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 4-[(2-benzyl-2-iodo-3-sulfanylpropanoyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(=O)C(I)(CS)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H22INO3S/c18-17(11-23,10-12-4-2-1-3-5-12)16(22)19-14-8-6-13(7-9-14)15(20)21/h1-5,13-14,23H,6-11H2,(H,19,22)(H,20,21) |
| InChIKey | ZXPMWSRBIHLPCZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|