C17H21NO4S — CID 119230024
4-[(2-phenacylsulfanylacetyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 119230024) has the molecular formula C17H21NO4S and a molecular weight of 335.42 g/mol. Its IUPAC name is 4-[(2-phenacylsulfanylacetyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-phenacylsulfanylacetyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119230024 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-[(2-phenacylsulfanylacetyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CSCC(=O)c1ccccc1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H21NO4S/c19-15(12-4-2-1-3-5-12)10-23-11-16(20)18-14-8-6-13(7-9-14)17(21)22/h1-5,13-14H,6-11H2,(H,18,20)(H,21,22) |
| InChIKey | GQABOXNZKYUZTA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |