C18H23NO3S — CID 15295917
4-[[2-(sulfanylmethyl)-1,3-dihydroindene-2-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 15295917) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 4-[[2-(sulfanylmethyl)-1,3-dihydroindene-2-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(sulfanylmethyl)-1,3-dihydroindene-2-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 15295917 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-[[2-(sulfanylmethyl)-1,3-dihydroindene-2-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(=O)C2(CS)Cc3ccccc3C2)CC1 |
| InChI | InChI=1S/C18H23NO3S/c20-16(21)12-5-7-15(8-6-12)19-17(22)18(11-23)9-13-3-1-2-4-14(13)10-18/h1-4,12,15,23H,5-11H2,(H,19,22)(H,20,21) |
| InChIKey | CTEZMYCUWMNYFZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|