About 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid
4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 14788218) has the molecular formula C9H12F3NO3
and a molecular weight of 239.19 g/mol. Its IUPAC name is 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid.
Analyze 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid (CID 14788218) is 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid is O=C(O)C1CCC(NC(=O)C(F)(F)F)CC1.
What is the InChIKey of 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid?
The InChIKey is GBQPSMFKYVJSJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO3/c10-9(11,12)8(16)13-6-3-1-5(2-4-6)7(14)15/h5-6H,1-4H2,(H,13,16)(H,14,15).
What are the key properties of 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid?
4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid has a molecular weight of 239.19 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 14788218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).